C20H15F2N3O3 — CID 58392042
4-[2-(3,5-dimethyl-1,2-oxazol-4-yl)-5,6-difluoro-3-[(E)-hydroxyiminomethyl]indol-1-yl]phenol (PubChem CID 58392042) has the molecular formula C20H15F2N3O3 and a molecular weight of 383.35 g/mol. Its IUPAC name is 4-[2-(3,5-dimethyl-1,2-oxazol-4-yl)-5,6-difluoro-3-[(E)-hydroxyiminomethyl]indol-1-yl]phenol.
| Compound Name | 4-[2-(3,5-dimethyl-1,2-oxazol-4-yl)-5,6-difluoro-3-[(E)-hydroxyiminomethyl]indol-1-yl]phenol |
|---|---|
| PubChem CID | 58392042 |
| Molecular Formula | C20H15F2N3O3 |
| Molecular Weight | 383.35 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | 4-[2-(3,5-dimethyl-1,2-oxazol-4-yl)-5,6-difluoro-3-[(E)-hydroxyiminomethyl]indol-1-yl]phenol |
| SMILES | Cc1noc(C)c1-c1c(/C=N/O)c2cc(F)c(F)cc2n1-c1ccc(O)cc1 |
| InChI | InChI=1S/C20H15F2N3O3/c1-10-19(11(2)28-24-10)20-15(9-23-27)14-7-16(21)17(22)8-18(14)25(20)12-3-5-13(26)6-4-12/h3-9,26-27H,1-2H3/b23-9+ |
| InChIKey | FPKQPHVPAKQLTE-NUGSKGIGSA-N |
| XLogP | 4.69 |
| TPSA | 83.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.35 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|