About cis-(1S,2S)-2-methylcyclopropane-1-carbonitrile
cis-(1S,2S)-2-methylcyclopropane-1-carbonitrile (PubChem CID 58392287) has the molecular formula C5H7N
and a molecular weight of 81.12 g/mol. Its IUPAC name is cis-(1S,2S)-2-methylcyclopropane-1-carbonitrile.
Molecular Properties
| Compound Name | cis-(1S,2S)-2-methylcyclopropane-1-carbonitrile |
| PubChem CID | 58392287 |
| Molecular Formula | C5H7N |
| Molecular Weight | 81.12 g/mol |
| Exact Mass | 81.06 |
| IUPAC Name | cis-(1S,2S)-2-methylcyclopropane-1-carbonitrile |
| SMILES | C[C@H]1C[C@@H]1C#N |
| InChI | InChI=1S/C5H7N/c1-4-2-5(4)3-6/h4-5H,2H2,1H3/t4-,5+/m0/s1 |
| InChIKey | MWIZMXFPLVYCEB-CRCLSJGQSA-N |
| XLogP | 1.17 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 81.12 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze cis-(1S,2S)-2-methylcyclopropane-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(1S,2S)-2-methylcyclopropane-1-carbonitrile?
The IUPAC name of cis-(1S,2S)-2-methylcyclopropane-1-carbonitrile (CID 58392287) is cis-(1S,2S)-2-methylcyclopropane-1-carbonitrile.
What is the SMILES notation for cis-(1S,2S)-2-methylcyclopropane-1-carbonitrile?
The canonical SMILES for cis-(1S,2S)-2-methylcyclopropane-1-carbonitrile is C[C@H]1C[C@@H]1C#N.
What is the InChIKey of cis-(1S,2S)-2-methylcyclopropane-1-carbonitrile?
The InChIKey is MWIZMXFPLVYCEB-CRCLSJGQSA-N. The full InChI is InChI=1S/C5H7N/c1-4-2-5(4)3-6/h4-5H,2H2,1H3/t4-,5+/m0/s1.
What are the key properties of cis-(1S,2S)-2-methylcyclopropane-1-carbonitrile?
cis-(1S,2S)-2-methylcyclopropane-1-carbonitrile has a molecular weight of 81.12 g/mol, XLogP of 1.17, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(1S,2S)-2-methylcyclopropane-1-carbonitrile is sourced from PubChem (CID 58392287), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).