About 3-[(2,4-difluorophenyl)-(4-fluorophenyl)methyl]-7-(methylsulfinylmethyl)-1H-indole
3-[(2,4-difluorophenyl)-(4-fluorophenyl)methyl]-7-(methylsulfinylmethyl)-1H-indole (PubChem CID 58392423) has the molecular formula C23H18F3NOS
and a molecular weight of 413.46 g/mol. Its IUPAC name is 3-[(2,4-difluorophenyl)-(4-fluorophenyl)methyl]-7-(methylsulfinylmethyl)-1H-indole.
Molecular Properties
| Compound Name | 3-[(2,4-difluorophenyl)-(4-fluorophenyl)methyl]-7-(methylsulfinylmethyl)-1H-indole |
| PubChem CID | 58392423 |
| Molecular Formula | C23H18F3NOS |
| Molecular Weight | 413.46 g/mol |
| Exact Mass | 413.11 |
| IUPAC Name | 3-[(2,4-difluorophenyl)-(4-fluorophenyl)methyl]-7-(methylsulfinylmethyl)-1H-indole |
| SMILES | CS(=O)Cc1cccc2c(C(c3ccc(F)cc3)c3ccc(F)cc3F)c[nH]c12 |
| InChI | InChI=1S/C23H18F3NOS/c1-29(28)13-15-3-2-4-18-20(12-27-23(15)18)22(14-5-7-16(24)8-6-14)19-10-9-17(25)11-21(19)26/h2-12,22,27H,13H2,1H3 |
| InChIKey | CTQDUQQNYWKZQJ-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 413.46 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-[(2,4-difluorophenyl)-(4-fluorophenyl)methyl]-7-(methylsulfinylmethyl)-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2,4-difluorophenyl)-(4-fluorophenyl)methyl]-7-(methylsulfinylmethyl)-1H-indole?
The IUPAC name of 3-[(2,4-difluorophenyl)-(4-fluorophenyl)methyl]-7-(methylsulfinylmethyl)-1H-indole (CID 58392423) is 3-[(2,4-difluorophenyl)-(4-fluorophenyl)methyl]-7-(methylsulfinylmethyl)-1H-indole.
What is the SMILES notation for 3-[(2,4-difluorophenyl)-(4-fluorophenyl)methyl]-7-(methylsulfinylmethyl)-1H-indole?
The canonical SMILES for 3-[(2,4-difluorophenyl)-(4-fluorophenyl)methyl]-7-(methylsulfinylmethyl)-1H-indole is CS(=O)Cc1cccc2c(C(c3ccc(F)cc3)c3ccc(F)cc3F)c[nH]c12.
What is the InChIKey of 3-[(2,4-difluorophenyl)-(4-fluorophenyl)methyl]-7-(methylsulfinylmethyl)-1H-indole?
The InChIKey is CTQDUQQNYWKZQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H18F3NOS/c1-29(28)13-15-3-2-4-18-20(12-27-23(15)18)22(14-5-7-16(24)8-6-14)19-10-9-17(25)11-21(19)26/h2-12,22,27H,13H2,1H3.
What are the key properties of 3-[(2,4-difluorophenyl)-(4-fluorophenyl)methyl]-7-(methylsulfinylmethyl)-1H-indole?
3-[(2,4-difluorophenyl)-(4-fluorophenyl)methyl]-7-(methylsulfinylmethyl)-1H-indole has a molecular weight of 413.46 g/mol, XLogP of 5.64, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2,4-difluorophenyl)-(4-fluorophenyl)methyl]-7-(methylsulfinylmethyl)-1H-indole is sourced from PubChem (CID 58392423), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).