C15H23NO5 — CID 58392625
ethyl (3aR,4R,7R,7aS)-7-acetamido-2,2,4-trimethyl-7,7a-dihydro-3aH-1,3-benzodioxole-4-carboxylate (PubChem CID 58392625) has the molecular formula C15H23NO5 and a molecular weight of 297.35 g/mol. Its IUPAC name is ethyl (3aR,4R,7R,7aS)-7-acetamido-2,2,4-trimethyl-7,7a-dihydro-3aH-1,3-benzodioxole-4-carboxylate.
| Compound Name | ethyl (3aR,4R,7R,7aS)-7-acetamido-2,2,4-trimethyl-7,7a-dihydro-3aH-1,3-benzodioxole-4-carboxylate |
|---|---|
| PubChem CID | 58392625 |
| Molecular Formula | C15H23NO5 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | ethyl (3aR,4R,7R,7aS)-7-acetamido-2,2,4-trimethyl-7,7a-dihydro-3aH-1,3-benzodioxole-4-carboxylate |
| SMILES | CCOC(=O)[C@]1(C)C=C[C@@H](NC(C)=O)[C@@H]2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C15H23NO5/c1-6-19-13(18)15(5)8-7-10(16-9(2)17)11-12(15)21-14(3,4)20-11/h7-8,10-12H,6H2,1-5H3,(H,16,17)/t10-,11+,12+,15-/m1/s1 |
| InChIKey | LQPONBDNKBTRFP-OXJKWZBOSA-N |
| XLogP | 1.15 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|