C15H22O5 — CID 58392634
ethyl (1R,2S,6S,7S)-4,4-diethyl-3,5,8-trioxatricyclo[5.2.2.02,6]undec-10-ene-7-carboxylate (PubChem CID 58392634) has the molecular formula C15H22O5 and a molecular weight of 282.34 g/mol. Its IUPAC name is ethyl (1R,2S,6S,7S)-4,4-diethyl-3,5,8-trioxatricyclo[5.2.2.02,6]undec-10-ene-7-carboxylate.
| Compound Name | ethyl (1R,2S,6S,7S)-4,4-diethyl-3,5,8-trioxatricyclo[5.2.2.02,6]undec-10-ene-7-carboxylate |
|---|---|
| PubChem CID | 58392634 |
| Molecular Formula | C15H22O5 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | ethyl (1R,2S,6S,7S)-4,4-diethyl-3,5,8-trioxatricyclo[5.2.2.02,6]undec-10-ene-7-carboxylate |
| SMILES | CCOC(=O)[C@@]12C=C[C@H](CO1)[C@@H]1OC(CC)(CC)O[C@@H]12 |
| InChI | InChI=1S/C15H22O5/c1-4-14(5-2)19-11-10-7-8-15(18-9-10,12(11)20-14)13(16)17-6-3/h7-8,10-12H,4-6,9H2,1-3H3/t10-,11+,12+,15+/m1/s1 |
| InChIKey | NQEXMJMOENBACF-YXMPFFBPSA-N |
| XLogP | 1.80 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|