C14H21NO6 — CID 58392640
ethyl (3aR,6R,7R,7aS)-7-acetamido-6-hydroxy-2,2-dimethyl-3a,6,7,7a-tetrahydro-1,3-benzodioxole-4-carboxylate (PubChem CID 58392640) has the molecular formula C14H21NO6 and a molecular weight of 299.32 g/mol. Its IUPAC name is ethyl (3aR,6R,7R,7aS)-7-acetamido-6-hydroxy-2,2-dimethyl-3a,6,7,7a-tetrahydro-1,3-benzodioxole-4-carboxylate.
| Compound Name | ethyl (3aR,6R,7R,7aS)-7-acetamido-6-hydroxy-2,2-dimethyl-3a,6,7,7a-tetrahydro-1,3-benzodioxole-4-carboxylate |
|---|---|
| PubChem CID | 58392640 |
| Molecular Formula | C14H21NO6 |
| Molecular Weight | 299.32 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | ethyl (3aR,6R,7R,7aS)-7-acetamido-6-hydroxy-2,2-dimethyl-3a,6,7,7a-tetrahydro-1,3-benzodioxole-4-carboxylate |
| SMILES | CCOC(=O)C1=C[C@@H](O)[C@@H](NC(C)=O)[C@@H]2OC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C14H21NO6/c1-5-19-13(18)8-6-9(17)10(15-7(2)16)12-11(8)20-14(3,4)21-12/h6,9-12,17H,5H2,1-4H3,(H,15,16)/t9-,10-,11-,12+/m1/s1 |
| InChIKey | PVYKYHWFOWSYJW-KKOKHZNYSA-N |
| XLogP | -0.12 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.32 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |