C30H34ClF2NO3 — CID 58392650
(1S,2S,4R,8S,9S,11S,12R,13S,19S)-8-acetyl-6-[(3-chlorophenyl)methyl]-12,19-difluoro-11-hydroxy-9,13-dimethyl-6-azapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-dien-16-one (PubChem CID 58392650) has the molecular formula C30H34ClF2NO3 and a molecular weight of 530.06 g/mol. Its IUPAC name is (1S,2S,4R,8S,9S,11S,12R,13S,19S)-8-acetyl-6-[(3-chlorophenyl)methyl]-12,19-difluoro-11-hydroxy-9,13-dimethyl-6-azapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-dien-16-one.
| Compound Name | (1S,2S,4R,8S,9S,11S,12R,13S,19S)-8-acetyl-6-[(3-chlorophenyl)methyl]-12,19-difluoro-11-hydroxy-9,13-dimethyl-6-azapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-dien-16-one |
|---|---|
| PubChem CID | 58392650 |
| Molecular Formula | C30H34ClF2NO3 |
| Molecular Weight | 530.06 g/mol |
| Exact Mass | 529.22 |
| IUPAC Name | (1S,2S,4R,8S,9S,11S,12R,13S,19S)-8-acetyl-6-[(3-chlorophenyl)methyl]-12,19-difluoro-11-hydroxy-9,13-dimethyl-6-azapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-dien-16-one |
| SMILES | CC(=O)[C@@]12CN(Cc3cccc(Cl)c3)C[C@@H]1C[C@H]1[C@@H]3C[C@H](F)C4=CC(=O)C=C[C@]4(C)[C@@]3(F)[C@@H](O)C[C@@]12C |
| InChI | InChI=1S/C30H34ClF2NO3/c1-17(35)29-16-34(14-18-5-4-6-20(31)9-18)15-19(29)10-22-23-12-25(32)24-11-21(36)7-8-27(24,2)30(23,33)26(37)13-28(22,29)3/h4-9,11,19,22-23,25-26,37H,10,12-16H2,1-3H3/t19-,22-,23-,25-,26-,27-,28-,29-,30-/m0/s1 |
| InChIKey | NGSNRDAYUOZWAA-YXEVYBQMSA-N |
| XLogP | 5.28 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.06 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |