C28H40O7 — CID 58392949
ethyl [(3S,5R,8R,9S,10S,13R,14S,17R)-14-hydroxy-10,13-dimethyl-17-(6-oxopyran-3-yl)-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl]oxymethyl carbonate (PubChem CID 58392949) has the molecular formula C28H40O7 and a molecular weight of 488.62 g/mol. Its IUPAC name is ethyl [(3S,5R,8R,9S,10S,13R,14S,17R)-14-hydroxy-10,13-dimethyl-17-(6-oxopyran-3-yl)-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl]oxymethyl carbonate.
| Compound Name | ethyl [(3S,5R,8R,9S,10S,13R,14S,17R)-14-hydroxy-10,13-dimethyl-17-(6-oxopyran-3-yl)-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl]oxymethyl carbonate |
|---|---|
| PubChem CID | 58392949 |
| Molecular Formula | C28H40O7 |
| Molecular Weight | 488.62 g/mol |
| Exact Mass | 488.28 |
| IUPAC Name | ethyl [(3S,5R,8R,9S,10S,13R,14S,17R)-14-hydroxy-10,13-dimethyl-17-(6-oxopyran-3-yl)-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl]oxymethyl carbonate |
| SMILES | CCOC(=O)OCO[C@H]1CC[C@@]2(C)[C@H](CC[C@@H]3[C@@H]2CC[C@]2(C)[C@@H](c4ccc(=O)oc4)CC[C@]32O)C1 |
| InChI | InChI=1S/C28H40O7/c1-4-32-25(30)35-17-34-20-9-12-26(2)19(15-20)6-7-23-22(26)10-13-27(3)21(11-14-28(23,27)31)18-5-8-24(29)33-16-18/h5,8,16,19-23,31H,4,6-7,9-15,17H2,1-3H3/t19-,20+,21-,22+,23-,26+,27-,28+/m1/s1 |
| InChIKey | OPRPIKOOWZGBRV-YXPVSBKJSA-N |
| XLogP | 5.40 |
| TPSA | 95.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.62 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|