C21H24F2N2O — CID 58393545
(3R)-1-[(1S,2S)-1-(2,4-difluorophenoxy)-1,2,3,4-tetrahydronaphthalen-2-yl]piperidin-3-amine (PubChem CID 58393545) has the molecular formula C21H24F2N2O and a molecular weight of 358.43 g/mol. Its IUPAC name is (3R)-1-[(1S,2S)-1-(2,4-difluorophenoxy)-1,2,3,4-tetrahydronaphthalen-2-yl]piperidin-3-amine.
| Compound Name | (3R)-1-[(1S,2S)-1-(2,4-difluorophenoxy)-1,2,3,4-tetrahydronaphthalen-2-yl]piperidin-3-amine |
|---|---|
| PubChem CID | 58393545 |
| Molecular Formula | C21H24F2N2O |
| Molecular Weight | 358.43 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | (3R)-1-[(1S,2S)-1-(2,4-difluorophenoxy)-1,2,3,4-tetrahydronaphthalen-2-yl]piperidin-3-amine |
| SMILES | N[C@@H]1CCCN([C@H]2CCc3ccccc3[C@@H]2Oc2ccc(F)cc2F)C1 |
| InChI | InChI=1S/C21H24F2N2O/c22-15-8-10-20(18(23)12-15)26-21-17-6-2-1-4-14(17)7-9-19(21)25-11-3-5-16(24)13-25/h1-2,4,6,8,10,12,16,19,21H,3,5,7,9,11,13,24H2/t16-,19+,21+/m1/s1 |
| InChIKey | CIPIDFXUOZAMRC-PBEJRMEISA-N |
| XLogP | 3.82 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.43 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |