C22H19Cl2FN2O5 — CID 58393683
3-[3-[[(1S,2S)-4,6-dichloro-2-[(3R)-3-hydroxypyrrolidin-1-yl]-2,3-dihydro-1H-inden-1-yl]oxy]-4-fluorophenyl]-1,3-oxazolidine-2,4-dione (PubChem CID 58393683) has the molecular formula C22H19Cl2FN2O5 and a molecular weight of 481.31 g/mol. Its IUPAC name is 3-[3-[[(1S,2S)-4,6-dichloro-2-[(3R)-3-hydroxypyrrolidin-1-yl]-2,3-dihydro-1H-inden-1-yl]oxy]-4-fluorophenyl]-1,3-oxazolidine-2,4-dione.
| Compound Name | 3-[3-[[(1S,2S)-4,6-dichloro-2-[(3R)-3-hydroxypyrrolidin-1-yl]-2,3-dihydro-1H-inden-1-yl]oxy]-4-fluorophenyl]-1,3-oxazolidine-2,4-dione |
|---|---|
| PubChem CID | 58393683 |
| Molecular Formula | C22H19Cl2FN2O5 |
| Molecular Weight | 481.31 g/mol |
| Exact Mass | 480.07 |
| IUPAC Name | 3-[3-[[(1S,2S)-4,6-dichloro-2-[(3R)-3-hydroxypyrrolidin-1-yl]-2,3-dihydro-1H-inden-1-yl]oxy]-4-fluorophenyl]-1,3-oxazolidine-2,4-dione |
| SMILES | O=C1COC(=O)N1c1ccc(F)c(O[C@H]2c3cc(Cl)cc(Cl)c3C[C@@H]2N2CC[C@@H](O)C2)c1 |
| InChI | InChI=1S/C22H19Cl2FN2O5/c23-11-5-15-14(16(24)6-11)8-18(26-4-3-13(28)9-26)21(15)32-19-7-12(1-2-17(19)25)27-20(29)10-31-22(27)30/h1-2,5-7,13,18,21,28H,3-4,8-10H2/t13-,18+,21+/m1/s1 |
| InChIKey | XSTYBVRUPKYGGM-MPKWNAGQSA-N |
| XLogP | 3.73 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.31 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |