About 1,1-dipropyl-2,3-dihydro-1-benzosilole
1,1-dipropyl-2,3-dihydro-1-benzosilole (PubChem CID 583937) has the molecular formula C14H22Si
and a molecular weight of 218.42 g/mol. Its IUPAC name is 1,1-dipropyl-2,3-dihydro-1-benzosilole.
Molecular Properties
| Compound Name | 1,1-dipropyl-2,3-dihydro-1-benzosilole |
| PubChem CID | 583937 |
| Molecular Formula | C14H22Si |
| Molecular Weight | 218.42 g/mol |
| Exact Mass | 218.15 |
| IUPAC Name | 1,1-dipropyl-2,3-dihydro-1-benzosilole |
| SMILES | CCC[Si]1(CCC)CCc2ccccc21 |
| InChI | InChI=1S/C14H22Si/c1-3-10-15(11-4-2)12-9-13-7-5-6-8-14(13)15/h5-8H,3-4,9-12H2,1-2H3 |
| InChIKey | BQBRUUXPJLTFDL-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.42 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1,1-dipropyl-2,3-dihydro-1-benzosilole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dipropyl-2,3-dihydro-1-benzosilole?
The IUPAC name of 1,1-dipropyl-2,3-dihydro-1-benzosilole (CID 583937) is 1,1-dipropyl-2,3-dihydro-1-benzosilole.
What is the SMILES notation for 1,1-dipropyl-2,3-dihydro-1-benzosilole?
The canonical SMILES for 1,1-dipropyl-2,3-dihydro-1-benzosilole is CCC[Si]1(CCC)CCc2ccccc21.
What is the InChIKey of 1,1-dipropyl-2,3-dihydro-1-benzosilole?
The InChIKey is BQBRUUXPJLTFDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22Si/c1-3-10-15(11-4-2)12-9-13-7-5-6-8-14(13)15/h5-8H,3-4,9-12H2,1-2H3.
What are the key properties of 1,1-dipropyl-2,3-dihydro-1-benzosilole?
1,1-dipropyl-2,3-dihydro-1-benzosilole has a molecular weight of 218.42 g/mol, XLogP of 3.72, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dipropyl-2,3-dihydro-1-benzosilole is sourced from PubChem (CID 583937), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).