C22H23F2N3O — CID 58393786
4-[[(1S,2S)-2-[(3R)-3-aminopiperidin-1-yl]-1,2,3,4-tetrahydronaphthalen-1-yl]oxy]-2,3-difluorobenzonitrile (PubChem CID 58393786) has the molecular formula C22H23F2N3O and a molecular weight of 383.44 g/mol. Its IUPAC name is 4-[[(1S,2S)-2-[(3R)-3-aminopiperidin-1-yl]-1,2,3,4-tetrahydronaphthalen-1-yl]oxy]-2,3-difluorobenzonitrile.
| Compound Name | 4-[[(1S,2S)-2-[(3R)-3-aminopiperidin-1-yl]-1,2,3,4-tetrahydronaphthalen-1-yl]oxy]-2,3-difluorobenzonitrile |
|---|---|
| PubChem CID | 58393786 |
| Molecular Formula | C22H23F2N3O |
| Molecular Weight | 383.44 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | 4-[[(1S,2S)-2-[(3R)-3-aminopiperidin-1-yl]-1,2,3,4-tetrahydronaphthalen-1-yl]oxy]-2,3-difluorobenzonitrile |
| SMILES | N#Cc1ccc(O[C@H]2c3ccccc3CC[C@@H]2N2CCC[C@@H](N)C2)c(F)c1F |
| InChI | InChI=1S/C22H23F2N3O/c23-20-15(12-25)8-10-19(21(20)24)28-22-17-6-2-1-4-14(17)7-9-18(22)27-11-3-5-16(26)13-27/h1-2,4,6,8,10,16,18,22H,3,5,7,9,11,13,26H2/t16-,18+,22+/m1/s1 |
| InChIKey | HURYRAUNTKGVIX-NRJQMVOHSA-N |
| XLogP | 3.69 |
| TPSA | 62.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.44 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |