About 3-[[(1R,2R)-2-pyrrolidin-1-yl-2,3-dihydro-1H-inden-1-yl]oxy]aniline
3-[[(1R,2R)-2-pyrrolidin-1-yl-2,3-dihydro-1H-inden-1-yl]oxy]aniline (PubChem CID 58393873) has the molecular formula C19H22N2O
and a molecular weight of 294.40 g/mol. Its IUPAC name is 3-[[(1R,2R)-2-pyrrolidin-1-yl-2,3-dihydro-1H-inden-1-yl]oxy]aniline.
Molecular Properties
| Compound Name | 3-[[(1R,2R)-2-pyrrolidin-1-yl-2,3-dihydro-1H-inden-1-yl]oxy]aniline |
| PubChem CID | 58393873 |
| Molecular Formula | C19H22N2O |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | 3-[[(1R,2R)-2-pyrrolidin-1-yl-2,3-dihydro-1H-inden-1-yl]oxy]aniline |
| SMILES | Nc1cccc(O[C@@H]2c3ccccc3C[C@H]2N2CCCC2)c1 |
| InChI | InChI=1S/C19H22N2O/c20-15-7-5-8-16(13-15)22-19-17-9-2-1-6-14(17)12-18(19)21-10-3-4-11-21/h1-2,5-9,13,18-19H,3-4,10-12,20H2/t18-,19-/m1/s1 |
| InChIKey | JTRGRSDTTZKURZ-RTBURBONSA-N |
| XLogP | 3.41 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-[[(1R,2R)-2-pyrrolidin-1-yl-2,3-dihydro-1H-inden-1-yl]oxy]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[(1R,2R)-2-pyrrolidin-1-yl-2,3-dihydro-1H-inden-1-yl]oxy]aniline?
The IUPAC name of 3-[[(1R,2R)-2-pyrrolidin-1-yl-2,3-dihydro-1H-inden-1-yl]oxy]aniline (CID 58393873) is 3-[[(1R,2R)-2-pyrrolidin-1-yl-2,3-dihydro-1H-inden-1-yl]oxy]aniline.
What is the SMILES notation for 3-[[(1R,2R)-2-pyrrolidin-1-yl-2,3-dihydro-1H-inden-1-yl]oxy]aniline?
The canonical SMILES for 3-[[(1R,2R)-2-pyrrolidin-1-yl-2,3-dihydro-1H-inden-1-yl]oxy]aniline is Nc1cccc(O[C@@H]2c3ccccc3C[C@H]2N2CCCC2)c1.
What is the InChIKey of 3-[[(1R,2R)-2-pyrrolidin-1-yl-2,3-dihydro-1H-inden-1-yl]oxy]aniline?
The InChIKey is JTRGRSDTTZKURZ-RTBURBONSA-N. The full InChI is InChI=1S/C19H22N2O/c20-15-7-5-8-16(13-15)22-19-17-9-2-1-6-14(17)12-18(19)21-10-3-4-11-21/h1-2,5-9,13,18-19H,3-4,10-12,20H2/t18-,19-/m1/s1.
What are the key properties of 3-[[(1R,2R)-2-pyrrolidin-1-yl-2,3-dihydro-1H-inden-1-yl]oxy]aniline?
3-[[(1R,2R)-2-pyrrolidin-1-yl-2,3-dihydro-1H-inden-1-yl]oxy]aniline has a molecular weight of 294.40 g/mol, XLogP of 3.41, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[(1R,2R)-2-pyrrolidin-1-yl-2,3-dihydro-1H-inden-1-yl]oxy]aniline is sourced from PubChem (CID 58393873), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).