C23H27N3O2 — CID 58393908
N-[3-[[(1R,2R)-2-[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-2,3-dihydro-1H-inden-1-yl]oxy]phenyl]acetamide (PubChem CID 58393908) has the molecular formula C23H27N3O2 and a molecular weight of 377.49 g/mol. Its IUPAC name is N-[3-[[(1R,2R)-2-[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-2,3-dihydro-1H-inden-1-yl]oxy]phenyl]acetamide.
| Compound Name | N-[3-[[(1R,2R)-2-[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-2,3-dihydro-1H-inden-1-yl]oxy]phenyl]acetamide |
|---|---|
| PubChem CID | 58393908 |
| Molecular Formula | C23H27N3O2 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.21 |
| IUPAC Name | N-[3-[[(1R,2R)-2-[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-2,3-dihydro-1H-inden-1-yl]oxy]phenyl]acetamide |
| SMILES | CC(=O)Nc1cccc(O[C@@H]2c3ccccc3C[C@H]2N2C[C@H]3CNC[C@H]3C2)c1 |
| InChI | InChI=1S/C23H27N3O2/c1-15(27)25-19-6-4-7-20(10-19)28-23-21-8-3-2-5-16(21)9-22(23)26-13-17-11-24-12-18(17)14-26/h2-8,10,17-18,22-24H,9,11-14H2,1H3,(H,25,27)/t17-,18+,22-,23-/m1/s1 |
| InChIKey | CJAIVJSWLWTALL-AAUAJYIVSA-N |
| XLogP | 2.84 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |