About CID 58394043
CID 58394043 (PubChem CID 58394043) has the molecular formula C7H4Cl2OS
and a molecular weight of 207.08 g/mol.
Molecular Properties
| Compound Name | CID 58394043 |
| PubChem CID | 58394043 |
| Molecular Formula | C7H4Cl2OS |
| Molecular Weight | 207.08 g/mol |
| Exact Mass | 205.94 |
| IUPAC Name | — |
| SMILES | [CH]CC(=O)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C7H4Cl2OS/c1-2-5(10)4-3-6(8)11-7(4)9/h1,3H,2H2 |
| InChIKey | PNAMYZRKUOIIPD-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.08 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 58394043 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 58394043?
The IUPAC name of CID 58394043 (CID 58394043) is not available.
What is the SMILES notation for CID 58394043?
The canonical SMILES for CID 58394043 is [CH]CC(=O)c1cc(Cl)sc1Cl.
What is the InChIKey of CID 58394043?
The InChIKey is PNAMYZRKUOIIPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4Cl2OS/c1-2-5(10)4-3-6(8)11-7(4)9/h1,3H,2H2.
What are the key properties of CID 58394043?
CID 58394043 has a molecular weight of 207.08 g/mol, XLogP of 3.34, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 58394043 is sourced from PubChem (CID 58394043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).