C23H24N2O3 — CID 58394053
1-[3-[[(1S,2S)-2-pyrrolidin-1-yl-2,3-dihydro-1H-inden-1-yl]oxy]phenyl]pyrrolidine-2,5-dione (PubChem CID 58394053) has the molecular formula C23H24N2O3 and a molecular weight of 376.46 g/mol. Its IUPAC name is 1-[3-[[(1S,2S)-2-pyrrolidin-1-yl-2,3-dihydro-1H-inden-1-yl]oxy]phenyl]pyrrolidine-2,5-dione.
| Compound Name | 1-[3-[[(1S,2S)-2-pyrrolidin-1-yl-2,3-dihydro-1H-inden-1-yl]oxy]phenyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 58394053 |
| Molecular Formula | C23H24N2O3 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | 1-[3-[[(1S,2S)-2-pyrrolidin-1-yl-2,3-dihydro-1H-inden-1-yl]oxy]phenyl]pyrrolidine-2,5-dione |
| SMILES | O=C1CCC(=O)N1c1cccc(O[C@H]2c3ccccc3C[C@@H]2N2CCCC2)c1 |
| InChI | InChI=1S/C23H24N2O3/c26-21-10-11-22(27)25(21)17-7-5-8-18(15-17)28-23-19-9-2-1-6-16(19)14-20(23)24-12-3-4-13-24/h1-2,5-9,15,20,23H,3-4,10-14H2/t20-,23-/m0/s1 |
| InChIKey | DQPJRDBDIKYSAM-REWPJTCUSA-N |
| XLogP | 3.48 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|