C26H33N3O — CID 58394132
(3aS,6aR)-5-[(1R,2R)-1-(3-piperidin-1-ylphenoxy)-2,3-dihydro-1H-inden-2-yl]-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole (PubChem CID 58394132) has the molecular formula C26H33N3O and a molecular weight of 403.57 g/mol. Its IUPAC name is (3aS,6aR)-5-[(1R,2R)-1-(3-piperidin-1-ylphenoxy)-2,3-dihydro-1H-inden-2-yl]-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole.
| Compound Name | (3aS,6aR)-5-[(1R,2R)-1-(3-piperidin-1-ylphenoxy)-2,3-dihydro-1H-inden-2-yl]-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole |
|---|---|
| PubChem CID | 58394132 |
| Molecular Formula | C26H33N3O |
| Molecular Weight | 403.57 g/mol |
| Exact Mass | 403.26 |
| IUPAC Name | (3aS,6aR)-5-[(1R,2R)-1-(3-piperidin-1-ylphenoxy)-2,3-dihydro-1H-inden-2-yl]-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole |
| SMILES | c1cc(O[C@@H]2c3ccccc3C[C@H]2N2C[C@H]3CNC[C@H]3C2)cc(N2CCCCC2)c1 |
| InChI | InChI=1S/C26H33N3O/c1-4-11-28(12-5-1)22-8-6-9-23(14-22)30-26-24-10-3-2-7-19(24)13-25(26)29-17-20-15-27-16-21(20)18-29/h2-3,6-10,14,20-21,25-27H,1,4-5,11-13,15-18H2/t20-,21+,25-,26-/m1/s1 |
| InChIKey | RIYHZBKHROECJU-WSAILGMDSA-N |
| XLogP | 3.87 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.57 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |