C18H22N4O2 — CID 58394482
tert-butyl 2-[3-(3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl)cyclobutyl]acetate (PubChem CID 58394482) has the molecular formula C18H22N4O2 and a molecular weight of 326.40 g/mol. Its IUPAC name is tert-butyl 2-[3-(3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl)cyclobutyl]acetate.
| Compound Name | tert-butyl 2-[3-(3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl)cyclobutyl]acetate |
|---|---|
| PubChem CID | 58394482 |
| Molecular Formula | C18H22N4O2 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | tert-butyl 2-[3-(3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl)cyclobutyl]acetate |
| SMILES | CC(C)(C)OC(=O)CC1CC(n2cnc3cnc4[nH]ccc4c32)C1 |
| InChI | InChI=1S/C18H22N4O2/c1-18(2,3)24-15(23)8-11-6-12(7-11)22-10-21-14-9-20-17-13(16(14)22)4-5-19-17/h4-5,9-12H,6-8H2,1-3H3,(H,19,20) |
| InChIKey | CGGXOZMLAOUSKC-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |