About 1-(4,4-difluoropiperidin-1-yl)-3,3-dimethylbutan-1-one
1-(4,4-difluoropiperidin-1-yl)-3,3-dimethylbutan-1-one (PubChem CID 58394601) has the molecular formula C11H19F2NO
and a molecular weight of 219.27 g/mol. Its IUPAC name is 1-(4,4-difluoropiperidin-1-yl)-3,3-dimethylbutan-1-one.
Molecular Properties
| Compound Name | 1-(4,4-difluoropiperidin-1-yl)-3,3-dimethylbutan-1-one |
| PubChem CID | 58394601 |
| Molecular Formula | C11H19F2NO |
| Molecular Weight | 219.27 g/mol |
| Exact Mass | 219.14 |
| IUPAC Name | 1-(4,4-difluoropiperidin-1-yl)-3,3-dimethylbutan-1-one |
| SMILES | CC(C)(C)CC(=O)N1CCC(F)(F)CC1 |
| InChI | InChI=1S/C11H19F2NO/c1-10(2,3)8-9(15)14-6-4-11(12,13)5-7-14/h4-8H2,1-3H3 |
| InChIKey | YQAINKWGZCIUGI-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.27 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(4,4-difluoropiperidin-1-yl)-3,3-dimethylbutan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4,4-difluoropiperidin-1-yl)-3,3-dimethylbutan-1-one?
The IUPAC name of 1-(4,4-difluoropiperidin-1-yl)-3,3-dimethylbutan-1-one (CID 58394601) is 1-(4,4-difluoropiperidin-1-yl)-3,3-dimethylbutan-1-one.
What is the SMILES notation for 1-(4,4-difluoropiperidin-1-yl)-3,3-dimethylbutan-1-one?
The canonical SMILES for 1-(4,4-difluoropiperidin-1-yl)-3,3-dimethylbutan-1-one is CC(C)(C)CC(=O)N1CCC(F)(F)CC1.
What is the InChIKey of 1-(4,4-difluoropiperidin-1-yl)-3,3-dimethylbutan-1-one?
The InChIKey is YQAINKWGZCIUGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19F2NO/c1-10(2,3)8-9(15)14-6-4-11(12,13)5-7-14/h4-8H2,1-3H3.
What are the key properties of 1-(4,4-difluoropiperidin-1-yl)-3,3-dimethylbutan-1-one?
1-(4,4-difluoropiperidin-1-yl)-3,3-dimethylbutan-1-one has a molecular weight of 219.27 g/mol, XLogP of 2.68, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4,4-difluoropiperidin-1-yl)-3,3-dimethylbutan-1-one is sourced from PubChem (CID 58394601), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).