C17H22N6O — CID 58394694
2-(dimethylamino)-1-[4-(3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl)piperidin-1-yl]ethanone (PubChem CID 58394694) has the molecular formula C17H22N6O and a molecular weight of 326.40 g/mol. Its IUPAC name is 2-(dimethylamino)-1-[4-(3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl)piperidin-1-yl]ethanone.
| Compound Name | 2-(dimethylamino)-1-[4-(3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl)piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 58394694 |
| Molecular Formula | C17H22N6O |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.19 |
| IUPAC Name | 2-(dimethylamino)-1-[4-(3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl)piperidin-1-yl]ethanone |
| SMILES | CN(C)CC(=O)N1CCC(n2cnc3cnc4[nH]ccc4c32)CC1 |
| InChI | InChI=1S/C17H22N6O/c1-21(2)10-15(24)22-7-4-12(5-8-22)23-11-20-14-9-19-17-13(16(14)23)3-6-18-17/h3,6,9,11-12H,4-5,7-8,10H2,1-2H3,(H,18,19) |
| InChIKey | INHVGQWGLDRMDI-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 70.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |