C14H17N5O2S — CID 58394745
3-(1-methylsulfonylpiperidin-4-yl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene (PubChem CID 58394745) has the molecular formula C14H17N5O2S and a molecular weight of 319.39 g/mol. Its IUPAC name is 3-(1-methylsulfonylpiperidin-4-yl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene.
| Compound Name | 3-(1-methylsulfonylpiperidin-4-yl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene |
|---|---|
| PubChem CID | 58394745 |
| Molecular Formula | C14H17N5O2S |
| Molecular Weight | 319.39 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | 3-(1-methylsulfonylpiperidin-4-yl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene |
| SMILES | CS(=O)(=O)N1CCC(n2cnc3cnc4[nH]ccc4c32)CC1 |
| InChI | InChI=1S/C14H17N5O2S/c1-22(20,21)18-6-3-10(4-7-18)19-9-17-12-8-16-14-11(13(12)19)2-5-15-14/h2,5,8-10H,3-4,6-7H2,1H3,(H,15,16) |
| InChIKey | MEPICMOJNYFIMV-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 83.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.39 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |