C17H22N4O2 — CID 58394787
(1R)-1-[3-(4-methoxycyclohexyl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]ethanol (PubChem CID 58394787) has the molecular formula C17H22N4O2 and a molecular weight of 314.39 g/mol. Its IUPAC name is (1R)-1-[3-(4-methoxycyclohexyl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]ethanol.
| Compound Name | (1R)-1-[3-(4-methoxycyclohexyl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]ethanol |
|---|---|
| PubChem CID | 58394787 |
| Molecular Formula | C17H22N4O2 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | (1R)-1-[3-(4-methoxycyclohexyl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]ethanol |
| SMILES | COC1CCC(n2c([C@@H](C)O)nc3cnc4[nH]ccc4c32)CC1 |
| InChI | InChI=1S/C17H22N4O2/c1-10(22)17-20-14-9-19-16-13(7-8-18-16)15(14)21(17)11-3-5-12(23-2)6-4-11/h7-12,22H,3-6H2,1-2H3,(H,18,19)/t10-,11?,12?/m1/s1 |
| InChIKey | XWRWZQJAOJYIJU-VOMCLLRMSA-N |
| XLogP | 3.10 |
| TPSA | 75.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |