About 4-tert-butyl-3,3-difluoropiperidine-1-carbaldehyde
4-tert-butyl-3,3-difluoropiperidine-1-carbaldehyde (PubChem CID 58394802) has the molecular formula C10H17F2NO
and a molecular weight of 205.25 g/mol. Its IUPAC name is 4-tert-butyl-3,3-difluoropiperidine-1-carbaldehyde.
Molecular Properties
| Compound Name | 4-tert-butyl-3,3-difluoropiperidine-1-carbaldehyde |
| PubChem CID | 58394802 |
| Molecular Formula | C10H17F2NO |
| Molecular Weight | 205.25 g/mol |
| Exact Mass | 205.13 |
| IUPAC Name | 4-tert-butyl-3,3-difluoropiperidine-1-carbaldehyde |
| SMILES | CC(C)(C)C1CCN(C=O)CC1(F)F |
| InChI | InChI=1S/C10H17F2NO/c1-9(2,3)8-4-5-13(7-14)6-10(8,11)12/h7-8H,4-6H2,1-3H3 |
| InChIKey | GFTKBQXJEJDGLG-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.25 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-tert-butyl-3,3-difluoropiperidine-1-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tert-butyl-3,3-difluoropiperidine-1-carbaldehyde?
The IUPAC name of 4-tert-butyl-3,3-difluoropiperidine-1-carbaldehyde (CID 58394802) is 4-tert-butyl-3,3-difluoropiperidine-1-carbaldehyde.
What is the SMILES notation for 4-tert-butyl-3,3-difluoropiperidine-1-carbaldehyde?
The canonical SMILES for 4-tert-butyl-3,3-difluoropiperidine-1-carbaldehyde is CC(C)(C)C1CCN(C=O)CC1(F)F.
What is the InChIKey of 4-tert-butyl-3,3-difluoropiperidine-1-carbaldehyde?
The InChIKey is GFTKBQXJEJDGLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17F2NO/c1-9(2,3)8-4-5-13(7-14)6-10(8,11)12/h7-8H,4-6H2,1-3H3.
What are the key properties of 4-tert-butyl-3,3-difluoropiperidine-1-carbaldehyde?
4-tert-butyl-3,3-difluoropiperidine-1-carbaldehyde has a molecular weight of 205.25 g/mol, XLogP of 2.15, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tert-butyl-3,3-difluoropiperidine-1-carbaldehyde is sourced from PubChem (CID 58394802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).