C19H19N5 — CID 58394916
3-[(3R)-1-benzylpyrrolidin-3-yl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene (PubChem CID 58394916) has the molecular formula C19H19N5 and a molecular weight of 317.40 g/mol. Its IUPAC name is 3-[(3R)-1-benzylpyrrolidin-3-yl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene.
| Compound Name | 3-[(3R)-1-benzylpyrrolidin-3-yl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene |
|---|---|
| PubChem CID | 58394916 |
| Molecular Formula | C19H19N5 |
| Molecular Weight | 317.40 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | 3-[(3R)-1-benzylpyrrolidin-3-yl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene |
| SMILES | c1ccc(CN2CC[C@@H](n3cnc4cnc5[nH]ccc5c43)C2)cc1 |
| InChI | InChI=1S/C19H19N5/c1-2-4-14(5-3-1)11-23-9-7-15(12-23)24-13-22-17-10-21-19-16(18(17)24)6-8-20-19/h1-6,8,10,13,15H,7,9,11-12H2,(H,20,21)/t15-/m1/s1 |
| InChIKey | KOPPQNKTLPWVND-OAHLLOKOSA-N |
| XLogP | 3.36 |
| TPSA | 49.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.40 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |