C18H21F2N5O2 — CID 58395195
2,2-difluoroethyl N-[4-(4-methyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl)cyclohexyl]carbamate (PubChem CID 58395195) has the molecular formula C18H21F2N5O2 and a molecular weight of 377.40 g/mol. Its IUPAC name is 2,2-difluoroethyl N-[4-(4-methyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl)cyclohexyl]carbamate.
| Compound Name | 2,2-difluoroethyl N-[4-(4-methyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl)cyclohexyl]carbamate |
|---|---|
| PubChem CID | 58395195 |
| Molecular Formula | C18H21F2N5O2 |
| Molecular Weight | 377.40 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | 2,2-difluoroethyl N-[4-(4-methyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl)cyclohexyl]carbamate |
| SMILES | Cc1nc2cnc3[nH]ccc3c2n1C1CCC(NC(=O)OCC(F)F)CC1 |
| InChI | InChI=1S/C18H21F2N5O2/c1-10-23-14-8-22-17-13(6-7-21-17)16(14)25(10)12-4-2-11(3-5-12)24-18(26)27-9-15(19)20/h6-8,11-12,15H,2-5,9H2,1H3,(H,21,22)(H,24,26) |
| InChIKey | NSMKISOJWLAAGK-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.40 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |