C18H23N7O2S — CID 58395250
N-[[3-[1-(2-cyanoethyl)piperidin-4-yl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]methyl]methanesulfonamide (PubChem CID 58395250) has the molecular formula C18H23N7O2S and a molecular weight of 401.50 g/mol. Its IUPAC name is N-[[3-[1-(2-cyanoethyl)piperidin-4-yl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]methyl]methanesulfonamide.
| Compound Name | N-[[3-[1-(2-cyanoethyl)piperidin-4-yl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]methyl]methanesulfonamide |
|---|---|
| PubChem CID | 58395250 |
| Molecular Formula | C18H23N7O2S |
| Molecular Weight | 401.50 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | N-[[3-[1-(2-cyanoethyl)piperidin-4-yl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]methyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NCc1nc2cnc3[nH]ccc3c2n1C1CCN(CCC#N)CC1 |
| InChI | InChI=1S/C18H23N7O2S/c1-28(26,27)22-12-16-23-15-11-21-18-14(3-7-20-18)17(15)25(16)13-4-9-24(10-5-13)8-2-6-19/h3,7,11,13,22H,2,4-5,8-10,12H2,1H3,(H,20,21) |
| InChIKey | YIOKZYGRSNWOOM-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 119.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.50 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |