C17H21F3N6O2S — CID 58395286
N-[[3-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]methyl]methanesulfonamide (PubChem CID 58395286) has the molecular formula C17H21F3N6O2S and a molecular weight of 430.46 g/mol. Its IUPAC name is N-[[3-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]methyl]methanesulfonamide.
| Compound Name | N-[[3-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]methyl]methanesulfonamide |
|---|---|
| PubChem CID | 58395286 |
| Molecular Formula | C17H21F3N6O2S |
| Molecular Weight | 430.46 g/mol |
| Exact Mass | 430.14 |
| IUPAC Name | N-[[3-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]methyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NCc1nc2cnc3[nH]ccc3c2n1C1CCN(CC(F)(F)F)CC1 |
| InChI | InChI=1S/C17H21F3N6O2S/c1-29(27,28)23-9-14-24-13-8-22-16-12(2-5-21-16)15(13)26(14)11-3-6-25(7-4-11)10-17(18,19)20/h2,5,8,11,23H,3-4,6-7,9-10H2,1H3,(H,21,22) |
| InChIKey | QCDYMUNPZWBSLY-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 95.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.46 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |