C18H23N5O — CID 58395383
4-[4-(3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl)cyclohexyl]morpholine (PubChem CID 58395383) has the molecular formula C18H23N5O and a molecular weight of 325.42 g/mol. Its IUPAC name is 4-[4-(3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl)cyclohexyl]morpholine.
| Compound Name | 4-[4-(3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl)cyclohexyl]morpholine |
|---|---|
| PubChem CID | 58395383 |
| Molecular Formula | C18H23N5O |
| Molecular Weight | 325.42 g/mol |
| Exact Mass | 325.19 |
| IUPAC Name | 4-[4-(3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl)cyclohexyl]morpholine |
| SMILES | c1cc2c(ncc3ncn(C4CCC(N5CCOCC5)CC4)c32)[nH]1 |
| InChI | InChI=1S/C18H23N5O/c1-3-14(4-2-13(1)22-7-9-24-10-8-22)23-12-21-16-11-20-18-15(17(16)23)5-6-19-18/h5-6,11-14H,1-4,7-10H2,(H,19,20) |
| InChIKey | SCIMUCMVZURYLT-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 58.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.42 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |