About 2-amino-6-(2,6-dichlorophenyl)-8-(pyridin-3-ylmethoxy)pyrido[2,3-d]pyrimidin-7-one
2-amino-6-(2,6-dichlorophenyl)-8-(pyridin-3-ylmethoxy)pyrido[2,3-d]pyrimidin-7-one (PubChem CID 58395567) has the molecular formula C19H13Cl2N5O2
and a molecular weight of 414.25 g/mol. Its IUPAC name is 2-amino-6-(2,6-dichlorophenyl)-8-(pyridin-3-ylmethoxy)pyrido[2,3-d]pyrimidin-7-one.
Molecular Properties
| Compound Name | 2-amino-6-(2,6-dichlorophenyl)-8-(pyridin-3-ylmethoxy)pyrido[2,3-d]pyrimidin-7-one |
| PubChem CID | 58395567 |
| Molecular Formula | C19H13Cl2N5O2 |
| Molecular Weight | 414.25 g/mol |
| Exact Mass | 413.04 |
| IUPAC Name | 2-amino-6-(2,6-dichlorophenyl)-8-(pyridin-3-ylmethoxy)pyrido[2,3-d]pyrimidin-7-one |
| SMILES | Nc1ncc2cc(-c3c(Cl)cccc3Cl)c(=O)n(OCc3cccnc3)c2n1 |
| InChI | InChI=1S/C19H13Cl2N5O2/c20-14-4-1-5-15(21)16(14)13-7-12-9-24-19(22)25-17(12)26(18(13)27)28-10-11-3-2-6-23-8-11/h1-9H,10H2,(H2,22,24,25) |
| InChIKey | GQDXDFUFQCMKDY-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 95.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 414.25 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-amino-6-(2,6-dichlorophenyl)-8-(pyridin-3-ylmethoxy)pyrido[2,3-d]pyrimidin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-6-(2,6-dichlorophenyl)-8-(pyridin-3-ylmethoxy)pyrido[2,3-d]pyrimidin-7-one?
The IUPAC name of 2-amino-6-(2,6-dichlorophenyl)-8-(pyridin-3-ylmethoxy)pyrido[2,3-d]pyrimidin-7-one (CID 58395567) is 2-amino-6-(2,6-dichlorophenyl)-8-(pyridin-3-ylmethoxy)pyrido[2,3-d]pyrimidin-7-one.
What is the SMILES notation for 2-amino-6-(2,6-dichlorophenyl)-8-(pyridin-3-ylmethoxy)pyrido[2,3-d]pyrimidin-7-one?
The canonical SMILES for 2-amino-6-(2,6-dichlorophenyl)-8-(pyridin-3-ylmethoxy)pyrido[2,3-d]pyrimidin-7-one is Nc1ncc2cc(-c3c(Cl)cccc3Cl)c(=O)n(OCc3cccnc3)c2n1.
What is the InChIKey of 2-amino-6-(2,6-dichlorophenyl)-8-(pyridin-3-ylmethoxy)pyrido[2,3-d]pyrimidin-7-one?
The InChIKey is GQDXDFUFQCMKDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H13Cl2N5O2/c20-14-4-1-5-15(21)16(14)13-7-12-9-24-19(22)25-17(12)26(18(13)27)28-10-11-3-2-6-23-8-11/h1-9H,10H2,(H2,22,24,25).
What are the key properties of 2-amino-6-(2,6-dichlorophenyl)-8-(pyridin-3-ylmethoxy)pyrido[2,3-d]pyrimidin-7-one?
2-amino-6-(2,6-dichlorophenyl)-8-(pyridin-3-ylmethoxy)pyrido[2,3-d]pyrimidin-7-one has a molecular weight of 414.25 g/mol, XLogP of 3.37, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-6-(2,6-dichlorophenyl)-8-(pyridin-3-ylmethoxy)pyrido[2,3-d]pyrimidin-7-one is sourced from PubChem (CID 58395567), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).