C32H29N3O5S2 — CID 58395864
N-(3-hydroxypropyl)-3-[4-(1H-inden-4-yl)-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridin-2-yl]benzenesulfonamide (PubChem CID 58395864) has the molecular formula C32H29N3O5S2 and a molecular weight of 599.73 g/mol. Its IUPAC name is N-(3-hydroxypropyl)-3-[4-(1H-inden-4-yl)-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridin-2-yl]benzenesulfonamide.
| Compound Name | N-(3-hydroxypropyl)-3-[4-(1H-inden-4-yl)-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridin-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 58395864 |
| Molecular Formula | C32H29N3O5S2 |
| Molecular Weight | 599.73 g/mol |
| Exact Mass | 599.15 |
| IUPAC Name | N-(3-hydroxypropyl)-3-[4-(1H-inden-4-yl)-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridin-2-yl]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)n2c(-c3cccc(S(=O)(=O)NCCCO)c3)cc3c(-c4cccc5c4C=CC5)ccnc32)cc1 |
| InChI | InChI=1S/C32H29N3O5S2/c1-22-12-14-25(15-13-22)42(39,40)35-31(24-8-2-9-26(20-24)41(37,38)34-17-5-19-36)21-30-29(16-18-33-32(30)35)28-11-4-7-23-6-3-10-27(23)28/h2-4,7-16,18,20-21,34,36H,5-6,17,19H2,1H3 |
| InChIKey | JBABYHKFHCJDNL-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.73 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|