C11H16BN2O2+ — CID 58395892
4-(4,5,5-trimethyl-4-methyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine (PubChem CID 58395892) has the molecular formula C11H16BN2O2+ and a molecular weight of 219.07 g/mol. Its IUPAC name is 4-(4,5,5-trimethyl-4-methyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine.
| Compound Name | 4-(4,5,5-trimethyl-4-methyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 58395892 |
| Molecular Formula | C11H16BN2O2+ |
| Molecular Weight | 219.07 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | 4-(4,5,5-trimethyl-4-methyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine |
| SMILES | [CH2+]C1(C)OB(c2ccnc(N)c2)OC1(C)C |
| InChI | InChI=1S/C11H16BN2O2/c1-10(2)11(3,4)16-12(15-10)8-5-6-14-9(13)7-8/h5-7H,1H2,2-4H3,(H2,13,14)/q+1 |
| InChIKey | BZZRRHQMJRCYNB-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.07 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|