About N-[(3R,4R)-4-hydroxypyrrolidin-3-yl]acetamide
N-[(3R,4R)-4-hydroxypyrrolidin-3-yl]acetamide (PubChem CID 58396031) has the molecular formula C6H12N2O2
and a molecular weight of 144.17 g/mol. Its IUPAC name is N-[(3R,4R)-4-hydroxypyrrolidin-3-yl]acetamide.
Molecular Properties
| Compound Name | N-[(3R,4R)-4-hydroxypyrrolidin-3-yl]acetamide |
| PubChem CID | 58396031 |
| Molecular Formula | C6H12N2O2 |
| Molecular Weight | 144.17 g/mol |
| Exact Mass | 144.09 |
| IUPAC Name | N-[(3R,4R)-4-hydroxypyrrolidin-3-yl]acetamide |
| SMILES | CC(=O)N[C@@H]1CNC[C@H]1O |
| InChI | InChI=1S/C6H12N2O2/c1-4(9)8-5-2-7-3-6(5)10/h5-7,10H,2-3H2,1H3,(H,8,9)/t5-,6-/m1/s1 |
| InChIKey | IEVZKJCULQLHIC-PHDIDXHHSA-N |
| XLogP | -1.54 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.17 |
| LogP ≤ 5 | -1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(3R,4R)-4-hydroxypyrrolidin-3-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3R,4R)-4-hydroxypyrrolidin-3-yl]acetamide?
The IUPAC name of N-[(3R,4R)-4-hydroxypyrrolidin-3-yl]acetamide (CID 58396031) is N-[(3R,4R)-4-hydroxypyrrolidin-3-yl]acetamide.
What is the SMILES notation for N-[(3R,4R)-4-hydroxypyrrolidin-3-yl]acetamide?
The canonical SMILES for N-[(3R,4R)-4-hydroxypyrrolidin-3-yl]acetamide is CC(=O)N[C@@H]1CNC[C@H]1O.
What is the InChIKey of N-[(3R,4R)-4-hydroxypyrrolidin-3-yl]acetamide?
The InChIKey is IEVZKJCULQLHIC-PHDIDXHHSA-N. The full InChI is InChI=1S/C6H12N2O2/c1-4(9)8-5-2-7-3-6(5)10/h5-7,10H,2-3H2,1H3,(H,8,9)/t5-,6-/m1/s1.
What are the key properties of N-[(3R,4R)-4-hydroxypyrrolidin-3-yl]acetamide?
N-[(3R,4R)-4-hydroxypyrrolidin-3-yl]acetamide has a molecular weight of 144.17 g/mol, XLogP of -1.54, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3R,4R)-4-hydroxypyrrolidin-3-yl]acetamide is sourced from PubChem (CID 58396031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).