C33H34F3N5O2 — CID 58396300
N-[3-methyl-4-[[3-[2-(4-piperidin-1-ylbutyl)pyrimidin-4-yl]-2-pyridinyl]oxy]phenyl]-3-(trifluoromethyl)benzamide (PubChem CID 58396300) has the molecular formula C33H34F3N5O2 and a molecular weight of 589.66 g/mol. Its IUPAC name is N-[3-methyl-4-[[3-[2-(4-piperidin-1-ylbutyl)pyrimidin-4-yl]-2-pyridinyl]oxy]phenyl]-3-(trifluoromethyl)benzamide.
| Compound Name | N-[3-methyl-4-[[3-[2-(4-piperidin-1-ylbutyl)pyrimidin-4-yl]-2-pyridinyl]oxy]phenyl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 58396300 |
| Molecular Formula | C33H34F3N5O2 |
| Molecular Weight | 589.66 g/mol |
| Exact Mass | 589.27 |
| IUPAC Name | N-[3-methyl-4-[[3-[2-(4-piperidin-1-ylbutyl)pyrimidin-4-yl]-2-pyridinyl]oxy]phenyl]-3-(trifluoromethyl)benzamide |
| SMILES | Cc1cc(NC(=O)c2cccc(C(F)(F)F)c2)ccc1Oc1ncccc1-c1ccnc(CCCCN2CCCCC2)n1 |
| InChI | InChI=1S/C33H34F3N5O2/c1-23-21-26(39-31(42)24-9-7-10-25(22-24)33(34,35)36)13-14-29(23)43-32-27(11-8-16-38-32)28-15-17-37-30(40-28)12-3-6-20-41-18-4-2-5-19-41/h7-11,13-17,21-22H,2-6,12,18-20H2,1H3,(H,39,42) |
| InChIKey | IVSVKMMWAIXQLW-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 80.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.66 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|