C27H21F4N3O3 — CID 58396437
N-[3-[[3-(2-ethyl-4-pyridinyl)-2-pyridinyl]oxy]phenyl]-3-(1,1,2,2-tetrafluoroethoxy)benzamide (PubChem CID 58396437) has the molecular formula C27H21F4N3O3 and a molecular weight of 511.48 g/mol. Its IUPAC name is N-[3-[[3-(2-ethyl-4-pyridinyl)-2-pyridinyl]oxy]phenyl]-3-(1,1,2,2-tetrafluoroethoxy)benzamide.
| Compound Name | N-[3-[[3-(2-ethyl-4-pyridinyl)-2-pyridinyl]oxy]phenyl]-3-(1,1,2,2-tetrafluoroethoxy)benzamide |
|---|---|
| PubChem CID | 58396437 |
| Molecular Formula | C27H21F4N3O3 |
| Molecular Weight | 511.48 g/mol |
| Exact Mass | 511.15 |
| IUPAC Name | N-[3-[[3-(2-ethyl-4-pyridinyl)-2-pyridinyl]oxy]phenyl]-3-(1,1,2,2-tetrafluoroethoxy)benzamide |
| SMILES | CCc1cc(-c2cccnc2Oc2cccc(NC(=O)c3cccc(OC(F)(F)C(F)F)c3)c2)ccn1 |
| InChI | InChI=1S/C27H21F4N3O3/c1-2-19-14-17(11-13-32-19)23-10-5-12-33-25(23)36-21-8-4-7-20(16-21)34-24(35)18-6-3-9-22(15-18)37-27(30,31)26(28)29/h3-16,26H,2H2,1H3,(H,34,35) |
| InChIKey | SFFPOUBOZNFCBR-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.48 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|