C27H19F3N4O2 — CID 58396664
3-[[3-(2-ethylpyrimidin-4-yl)-2-pyridinyl]oxy]-5-ethynyl-N-[3-(trifluoromethyl)phenyl]benzamide (PubChem CID 58396664) has the molecular formula C27H19F3N4O2 and a molecular weight of 488.47 g/mol. Its IUPAC name is 3-[[3-(2-ethylpyrimidin-4-yl)-2-pyridinyl]oxy]-5-ethynyl-N-[3-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 3-[[3-(2-ethylpyrimidin-4-yl)-2-pyridinyl]oxy]-5-ethynyl-N-[3-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 58396664 |
| Molecular Formula | C27H19F3N4O2 |
| Molecular Weight | 488.47 g/mol |
| Exact Mass | 488.15 |
| IUPAC Name | 3-[[3-(2-ethylpyrimidin-4-yl)-2-pyridinyl]oxy]-5-ethynyl-N-[3-(trifluoromethyl)phenyl]benzamide |
| SMILES | C#Cc1cc(Oc2ncccc2-c2ccnc(CC)n2)cc(C(=O)Nc2cccc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C27H19F3N4O2/c1-3-17-13-18(25(35)33-20-8-5-7-19(16-20)27(28,29)30)15-21(14-17)36-26-22(9-6-11-32-26)23-10-12-31-24(4-2)34-23/h1,5-16H,4H2,2H3,(H,33,35) |
| InChIKey | FFAFRFGKTZFJPM-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.47 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|