C26H19ClF4N4O3 — CID 58396676
N-[2-chloro-5-[[3-(2-ethylpyrimidin-4-yl)-2-pyridinyl]oxy]phenyl]-3-(1,1,2,2-tetrafluoroethoxy)benzamide (PubChem CID 58396676) has the molecular formula C26H19ClF4N4O3 and a molecular weight of 546.91 g/mol. Its IUPAC name is N-[2-chloro-5-[[3-(2-ethylpyrimidin-4-yl)-2-pyridinyl]oxy]phenyl]-3-(1,1,2,2-tetrafluoroethoxy)benzamide.
| Compound Name | N-[2-chloro-5-[[3-(2-ethylpyrimidin-4-yl)-2-pyridinyl]oxy]phenyl]-3-(1,1,2,2-tetrafluoroethoxy)benzamide |
|---|---|
| PubChem CID | 58396676 |
| Molecular Formula | C26H19ClF4N4O3 |
| Molecular Weight | 546.91 g/mol |
| Exact Mass | 546.11 |
| IUPAC Name | N-[2-chloro-5-[[3-(2-ethylpyrimidin-4-yl)-2-pyridinyl]oxy]phenyl]-3-(1,1,2,2-tetrafluoroethoxy)benzamide |
| SMILES | CCc1nccc(-c2cccnc2Oc2ccc(Cl)c(NC(=O)c3cccc(OC(F)(F)C(F)F)c3)c2)n1 |
| InChI | InChI=1S/C26H19ClF4N4O3/c1-2-22-32-12-10-20(34-22)18-7-4-11-33-24(18)37-16-8-9-19(27)21(14-16)35-23(36)15-5-3-6-17(13-15)38-26(30,31)25(28)29/h3-14,25H,2H2,1H3,(H,35,36) |
| InChIKey | HVOOHSDLNHTZGK-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 86.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.91 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|