C23H20N6O2 — CID 58397000
1-[4-[[3-(4-ethyl-1,3,5-triazin-2-yl)-2-pyridinyl]oxy]phenyl]-3-phenylurea (PubChem CID 58397000) has the molecular formula C23H20N6O2 and a molecular weight of 412.45 g/mol. Its IUPAC name is 1-[4-[[3-(4-ethyl-1,3,5-triazin-2-yl)-2-pyridinyl]oxy]phenyl]-3-phenylurea.
| Compound Name | 1-[4-[[3-(4-ethyl-1,3,5-triazin-2-yl)-2-pyridinyl]oxy]phenyl]-3-phenylurea |
|---|---|
| PubChem CID | 58397000 |
| Molecular Formula | C23H20N6O2 |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | 1-[4-[[3-(4-ethyl-1,3,5-triazin-2-yl)-2-pyridinyl]oxy]phenyl]-3-phenylurea |
| SMILES | CCc1ncnc(-c2cccnc2Oc2ccc(NC(=O)Nc3ccccc3)cc2)n1 |
| InChI | InChI=1S/C23H20N6O2/c1-2-20-25-15-26-21(29-20)19-9-6-14-24-22(19)31-18-12-10-17(11-13-18)28-23(30)27-16-7-4-3-5-8-16/h3-15H,2H2,1H3,(H2,27,28,30) |
| InChIKey | YPDNOUQHCKDGNI-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 101.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |