C22H21F3N4O2S — CID 58397381
6-hydroxy-1-[1-methyl-2-[[6-(trifluoromethyl)-1,3-benzothiazol-2-yl]amino]benzimidazol-5-yl]hexan-1-one (PubChem CID 58397381) has the molecular formula C22H21F3N4O2S and a molecular weight of 462.50 g/mol. Its IUPAC name is 6-hydroxy-1-[1-methyl-2-[[6-(trifluoromethyl)-1,3-benzothiazol-2-yl]amino]benzimidazol-5-yl]hexan-1-one.
| Compound Name | 6-hydroxy-1-[1-methyl-2-[[6-(trifluoromethyl)-1,3-benzothiazol-2-yl]amino]benzimidazol-5-yl]hexan-1-one |
|---|---|
| PubChem CID | 58397381 |
| Molecular Formula | C22H21F3N4O2S |
| Molecular Weight | 462.50 g/mol |
| Exact Mass | 462.13 |
| IUPAC Name | 6-hydroxy-1-[1-methyl-2-[[6-(trifluoromethyl)-1,3-benzothiazol-2-yl]amino]benzimidazol-5-yl]hexan-1-one |
| SMILES | Cn1c(Nc2nc3ccc(C(F)(F)F)cc3s2)nc2cc(C(=O)CCCCCO)ccc21 |
| InChI | InChI=1S/C22H21F3N4O2S/c1-29-17-9-6-13(18(31)5-3-2-4-10-30)11-16(17)26-20(29)28-21-27-15-8-7-14(22(23,24)25)12-19(15)32-21/h6-9,11-12,30H,2-5,10H2,1H3,(H,26,27,28) |
| InChIKey | ORXATBCOKYPRDZ-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.50 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|