C25H26F3N5O4S — CID 58397407
tert-butyl N-[4-[1-methyl-2-[[6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]amino]benzimidazol-5-yl]-4-oxobutyl]carbamate (PubChem CID 58397407) has the molecular formula C25H26F3N5O4S and a molecular weight of 549.58 g/mol. Its IUPAC name is tert-butyl N-[4-[1-methyl-2-[[6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]amino]benzimidazol-5-yl]-4-oxobutyl]carbamate.
| Compound Name | tert-butyl N-[4-[1-methyl-2-[[6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]amino]benzimidazol-5-yl]-4-oxobutyl]carbamate |
|---|---|
| PubChem CID | 58397407 |
| Molecular Formula | C25H26F3N5O4S |
| Molecular Weight | 549.58 g/mol |
| Exact Mass | 549.17 |
| IUPAC Name | tert-butyl N-[4-[1-methyl-2-[[6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]amino]benzimidazol-5-yl]-4-oxobutyl]carbamate |
| SMILES | Cn1c(Nc2nc3ccc(OC(F)(F)F)cc3s2)nc2cc(C(=O)CCCNC(=O)OC(C)(C)C)ccc21 |
| InChI | InChI=1S/C25H26F3N5O4S/c1-24(2,3)37-23(35)29-11-5-6-19(34)14-7-10-18-17(12-14)30-21(33(18)4)32-22-31-16-9-8-15(13-20(16)38-22)36-25(26,27)28/h7-10,12-13H,5-6,11H2,1-4H3,(H,29,35)(H,30,31,32) |
| InChIKey | ITSDGPVJHNXPTO-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 107.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.58 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|