C25H28F3N5OS — CID 58397435
5-(diethylamino)-1-[1-methyl-2-[[6-(trifluoromethyl)-1,3-benzothiazol-2-yl]amino]benzimidazol-5-yl]pentan-1-one (PubChem CID 58397435) has the molecular formula C25H28F3N5OS and a molecular weight of 503.59 g/mol. Its IUPAC name is 5-(diethylamino)-1-[1-methyl-2-[[6-(trifluoromethyl)-1,3-benzothiazol-2-yl]amino]benzimidazol-5-yl]pentan-1-one.
| Compound Name | 5-(diethylamino)-1-[1-methyl-2-[[6-(trifluoromethyl)-1,3-benzothiazol-2-yl]amino]benzimidazol-5-yl]pentan-1-one |
|---|---|
| PubChem CID | 58397435 |
| Molecular Formula | C25H28F3N5OS |
| Molecular Weight | 503.59 g/mol |
| Exact Mass | 503.20 |
| IUPAC Name | 5-(diethylamino)-1-[1-methyl-2-[[6-(trifluoromethyl)-1,3-benzothiazol-2-yl]amino]benzimidazol-5-yl]pentan-1-one |
| SMILES | CCN(CC)CCCCC(=O)c1ccc2c(c1)nc(Nc1nc3ccc(C(F)(F)F)cc3s1)n2C |
| InChI | InChI=1S/C25H28F3N5OS/c1-4-33(5-2)13-7-6-8-21(34)16-9-12-20-19(14-16)29-23(32(20)3)31-24-30-18-11-10-17(25(26,27)28)15-22(18)35-24/h9-12,14-15H,4-8,13H2,1-3H3,(H,29,30,31) |
| InChIKey | DPMWKZLRLMYYBU-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.59 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|