C20H19FN4O2S — CID 58397734
1-[2-[(5-fluoro-1,3-benzothiazol-2-yl)amino]-1-methylbenzimidazol-5-yl]-4-methoxybutan-1-one (PubChem CID 58397734) has the molecular formula C20H19FN4O2S and a molecular weight of 398.46 g/mol. Its IUPAC name is 1-[2-[(5-fluoro-1,3-benzothiazol-2-yl)amino]-1-methylbenzimidazol-5-yl]-4-methoxybutan-1-one.
| Compound Name | 1-[2-[(5-fluoro-1,3-benzothiazol-2-yl)amino]-1-methylbenzimidazol-5-yl]-4-methoxybutan-1-one |
|---|---|
| PubChem CID | 58397734 |
| Molecular Formula | C20H19FN4O2S |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | 1-[2-[(5-fluoro-1,3-benzothiazol-2-yl)amino]-1-methylbenzimidazol-5-yl]-4-methoxybutan-1-one |
| SMILES | COCCCC(=O)c1ccc2c(c1)nc(Nc1nc3cc(F)ccc3s1)n2C |
| InChI | InChI=1S/C20H19FN4O2S/c1-25-16-7-5-12(17(26)4-3-9-27-2)10-14(16)22-19(25)24-20-23-15-11-13(21)6-8-18(15)28-20/h5-8,10-11H,3-4,9H2,1-2H3,(H,22,23,24) |
| InChIKey | LFRBDIDJLKIVGY-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|