C20H16F5N7O — CID 58397871
N-[3,3-difluoro-1-(5-methyl-1,3,4-oxadiazol-2-yl)piperidin-4-yl]-8-(2,3,4-trifluorophenyl)-[1,2,4]triazolo[1,5-a]pyridin-2-amine (PubChem CID 58397871) has the molecular formula C20H16F5N7O and a molecular weight of 465.39 g/mol. Its IUPAC name is N-[3,3-difluoro-1-(5-methyl-1,3,4-oxadiazol-2-yl)piperidin-4-yl]-8-(2,3,4-trifluorophenyl)-[1,2,4]triazolo[1,5-a]pyridin-2-amine.
| Compound Name | N-[3,3-difluoro-1-(5-methyl-1,3,4-oxadiazol-2-yl)piperidin-4-yl]-8-(2,3,4-trifluorophenyl)-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
|---|---|
| PubChem CID | 58397871 |
| Molecular Formula | C20H16F5N7O |
| Molecular Weight | 465.39 g/mol |
| Exact Mass | 465.13 |
| IUPAC Name | N-[3,3-difluoro-1-(5-methyl-1,3,4-oxadiazol-2-yl)piperidin-4-yl]-8-(2,3,4-trifluorophenyl)-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
| SMILES | Cc1nnc(N2CCC(Nc3nc4c(-c5ccc(F)c(F)c5F)cccn4n3)C(F)(F)C2)o1 |
| InChI | InChI=1S/C20H16F5N7O/c1-10-28-29-19(33-10)31-8-6-14(20(24,25)9-31)26-18-27-17-12(3-2-7-32(17)30-18)11-4-5-13(21)16(23)15(11)22/h2-5,7,14H,6,8-9H2,1H3,(H,26,30) |
| InChIKey | BISCXHFSPBDQFI-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 84.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.39 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|