C22H18F7N7O — CID 58397888
8-[3,5-bis(trifluoromethyl)phenyl]-N-[(3R,4S)-3-fluoro-1-(5-methyl-1,3,4-oxadiazol-2-yl)piperidin-4-yl]-[1,2,4]triazolo[1,5-a]pyridin-2-amine (PubChem CID 58397888) has the molecular formula C22H18F7N7O and a molecular weight of 529.42 g/mol. Its IUPAC name is 8-[3,5-bis(trifluoromethyl)phenyl]-N-[(3R,4S)-3-fluoro-1-(5-methyl-1,3,4-oxadiazol-2-yl)piperidin-4-yl]-[1,2,4]triazolo[1,5-a]pyridin-2-amine.
| Compound Name | 8-[3,5-bis(trifluoromethyl)phenyl]-N-[(3R,4S)-3-fluoro-1-(5-methyl-1,3,4-oxadiazol-2-yl)piperidin-4-yl]-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
|---|---|
| PubChem CID | 58397888 |
| Molecular Formula | C22H18F7N7O |
| Molecular Weight | 529.42 g/mol |
| Exact Mass | 529.15 |
| IUPAC Name | 8-[3,5-bis(trifluoromethyl)phenyl]-N-[(3R,4S)-3-fluoro-1-(5-methyl-1,3,4-oxadiazol-2-yl)piperidin-4-yl]-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
| SMILES | Cc1nnc(N2CC[C@H](Nc3nc4c(-c5cc(C(F)(F)F)cc(C(F)(F)F)c5)cccn4n3)[C@H](F)C2)o1 |
| InChI | InChI=1S/C22H18F7N7O/c1-11-32-33-20(37-11)35-6-4-17(16(23)10-35)30-19-31-18-15(3-2-5-36(18)34-19)12-7-13(21(24,25)26)9-14(8-12)22(27,28)29/h2-3,5,7-9,16-17H,4,6,10H2,1H3,(H,30,34)/t16-,17+/m1/s1 |
| InChIKey | ZUIMQOVZAWTGAU-SJORKVTESA-N |
| XLogP | 5.15 |
| TPSA | 84.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.42 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |