C23H20F4N6O — CID 58397919
N-[(3S,4R)-3-fluoro-1-(2-methoxy-4-pyridinyl)piperidin-4-yl]-8-(2,3,4-trifluorophenyl)-[1,2,4]triazolo[1,5-a]pyridin-2-amine (PubChem CID 58397919) has the molecular formula C23H20F4N6O and a molecular weight of 472.45 g/mol. Its IUPAC name is N-[(3S,4R)-3-fluoro-1-(2-methoxy-4-pyridinyl)piperidin-4-yl]-8-(2,3,4-trifluorophenyl)-[1,2,4]triazolo[1,5-a]pyridin-2-amine.
| Compound Name | N-[(3S,4R)-3-fluoro-1-(2-methoxy-4-pyridinyl)piperidin-4-yl]-8-(2,3,4-trifluorophenyl)-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
|---|---|
| PubChem CID | 58397919 |
| Molecular Formula | C23H20F4N6O |
| Molecular Weight | 472.45 g/mol |
| Exact Mass | 472.16 |
| IUPAC Name | N-[(3S,4R)-3-fluoro-1-(2-methoxy-4-pyridinyl)piperidin-4-yl]-8-(2,3,4-trifluorophenyl)-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
| SMILES | COc1cc(N2CC[C@@H](Nc3nc4c(-c5ccc(F)c(F)c5F)cccn4n3)[C@@H](F)C2)ccn1 |
| InChI | InChI=1S/C23H20F4N6O/c1-34-19-11-13(6-8-28-19)32-10-7-18(17(25)12-32)29-23-30-22-15(3-2-9-33(22)31-23)14-4-5-16(24)21(27)20(14)26/h2-6,8-9,11,17-18H,7,10,12H2,1H3,(H,29,31)/t17-,18+/m0/s1 |
| InChIKey | PWVGDSKENVNPHA-ZWKOTPCHSA-N |
| XLogP | 4.25 |
| TPSA | 67.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.45 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|