C23H31ClN7O2+ — CID 58398776
2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]ethyl-[6-(1H-indol-3-yl)-5-oxohexyl]-dimethylazanium (PubChem CID 58398776) has the molecular formula C23H31ClN7O2+ and a molecular weight of 473.00 g/mol. Its IUPAC name is 2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]ethyl-[6-(1H-indol-3-yl)-5-oxohexyl]-dimethylazanium.
| Compound Name | 2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]ethyl-[6-(1H-indol-3-yl)-5-oxohexyl]-dimethylazanium |
|---|---|
| PubChem CID | 58398776 |
| Molecular Formula | C23H31ClN7O2+ |
| Molecular Weight | 473.00 g/mol |
| Exact Mass | 472.22 |
| IUPAC Name | 2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]ethyl-[6-(1H-indol-3-yl)-5-oxohexyl]-dimethylazanium |
| SMILES | C[N+](C)(CCCCC(=O)Cc1c[nH]c2ccccc12)CCNC(=O)c1nc(Cl)c(N)nc1N |
| InChI | InChI=1S/C23H30ClN7O2/c1-31(2,12-10-27-23(33)19-21(25)30-22(26)20(24)29-19)11-6-5-7-16(32)13-15-14-28-18-9-4-3-8-17(15)18/h3-4,8-9,14,28H,5-7,10-13H2,1-2H3,(H4-,25,26,27,30,33)/p+1 |
| InChIKey | SDUJXBHNGHYXBP-UHFFFAOYSA-O |
| XLogP | 2.56 |
| TPSA | 139.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.00 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|