C30H40ClN8O5S+ — CID 58398848
2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]ethyl-[2-[[3-[3-(2-iminopropylsulfonyl)-4-methoxyphenyl]-3-phenylpropanoyl]amino]ethyl]-dimethylazanium (PubChem CID 58398848) has the molecular formula C30H40ClN8O5S+ and a molecular weight of 660.22 g/mol. Its IUPAC name is 2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]ethyl-[2-[[3-[3-(2-iminopropylsulfonyl)-4-methoxyphenyl]-3-phenylpropanoyl]amino]ethyl]-dimethylazanium.
| Compound Name | 2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]ethyl-[2-[[3-[3-(2-iminopropylsulfonyl)-4-methoxyphenyl]-3-phenylpropanoyl]amino]ethyl]-dimethylazanium |
|---|---|
| PubChem CID | 58398848 |
| Molecular Formula | C30H40ClN8O5S+ |
| Molecular Weight | 660.22 g/mol |
| Exact Mass | 659.25 |
| IUPAC Name | 2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]ethyl-[2-[[3-[3-(2-iminopropylsulfonyl)-4-methoxyphenyl]-3-phenylpropanoyl]amino]ethyl]-dimethylazanium |
| SMILES | [H]/N=C(\C)CS(=O)(=O)c1cc(C(CC(=O)NCC[N+](C)(C)CCNC(=O)c2nc(Cl)c(N)nc2N)c2ccccc2)ccc1OC |
| InChI | InChI=1S/C30H39ClN8O5S/c1-19(32)18-45(42,43)24-16-21(10-11-23(24)44-4)22(20-8-6-5-7-9-20)17-25(40)35-12-14-39(2,3)15-13-36-30(41)26-28(33)38-29(34)27(31)37-26/h5-11,16,22,32H,12-15,17-18H2,1-4H3,(H5-,33,34,35,36,38,40,41)/p+1/b32-19+ |
| InChIKey | SILNPKAPBKKWJC-BIZUNTBRSA-O |
| XLogP | 2.26 |
| TPSA | 203.24 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.22 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|