About 2-chloro-7-methyl-5H-pyrrolo[2,3-d]pyrimidin-6-one
2-chloro-7-methyl-5H-pyrrolo[2,3-d]pyrimidin-6-one (PubChem CID 58398943) has the molecular formula C7H6ClN3O
and a molecular weight of 183.60 g/mol. Its IUPAC name is 2-chloro-7-methyl-5H-pyrrolo[2,3-d]pyrimidin-6-one.
Molecular Properties
| Compound Name | 2-chloro-7-methyl-5H-pyrrolo[2,3-d]pyrimidin-6-one |
| PubChem CID | 58398943 |
| Molecular Formula | C7H6ClN3O |
| Molecular Weight | 183.60 g/mol |
| Exact Mass | 183.02 |
| IUPAC Name | 2-chloro-7-methyl-5H-pyrrolo[2,3-d]pyrimidin-6-one |
| SMILES | CN1C(=O)Cc2cnc(Cl)nc21 |
| InChI | InChI=1S/C7H6ClN3O/c1-11-5(12)2-4-3-9-7(8)10-6(4)11/h3H,2H2,1H3 |
| InChIKey | MTAFMEFZDADRMV-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.60 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-chloro-7-methyl-5H-pyrrolo[2,3-d]pyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-7-methyl-5H-pyrrolo[2,3-d]pyrimidin-6-one?
The IUPAC name of 2-chloro-7-methyl-5H-pyrrolo[2,3-d]pyrimidin-6-one (CID 58398943) is 2-chloro-7-methyl-5H-pyrrolo[2,3-d]pyrimidin-6-one.
What is the SMILES notation for 2-chloro-7-methyl-5H-pyrrolo[2,3-d]pyrimidin-6-one?
The canonical SMILES for 2-chloro-7-methyl-5H-pyrrolo[2,3-d]pyrimidin-6-one is CN1C(=O)Cc2cnc(Cl)nc21.
What is the InChIKey of 2-chloro-7-methyl-5H-pyrrolo[2,3-d]pyrimidin-6-one?
The InChIKey is MTAFMEFZDADRMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6ClN3O/c1-11-5(12)2-4-3-9-7(8)10-6(4)11/h3H,2H2,1H3.
What are the key properties of 2-chloro-7-methyl-5H-pyrrolo[2,3-d]pyrimidin-6-one?
2-chloro-7-methyl-5H-pyrrolo[2,3-d]pyrimidin-6-one has a molecular weight of 183.60 g/mol, XLogP of 0.65, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-7-methyl-5H-pyrrolo[2,3-d]pyrimidin-6-one is sourced from PubChem (CID 58398943), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).