About CID 58399109
CID 58399109 (PubChem CID 58399109) has the molecular formula C19H18N2O
and a molecular weight of 290.37 g/mol.
Molecular Properties
| Compound Name | CID 58399109 |
| PubChem CID | 58399109 |
| Molecular Formula | C19H18N2O |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | — |
| SMILES | [CH]n1c(CCC(C)=O)nc2c(C)cc(-c3ccccc3)cc21 |
| InChI | InChI=1S/C19H18N2O/c1-13-11-16(15-7-5-4-6-8-15)12-17-19(13)20-18(21(17)3)10-9-14(2)22/h3-8,11-12H,9-10H2,1-2H3 |
| InChIKey | URGOJRQFQXSANZ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze CID 58399109 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 58399109?
The IUPAC name of CID 58399109 (CID 58399109) is not available.
What is the SMILES notation for CID 58399109?
The canonical SMILES for CID 58399109 is [CH]n1c(CCC(C)=O)nc2c(C)cc(-c3ccccc3)cc21.
What is the InChIKey of CID 58399109?
The InChIKey is URGOJRQFQXSANZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18N2O/c1-13-11-16(15-7-5-4-6-8-15)12-17-19(13)20-18(21(17)3)10-9-14(2)22/h3-8,11-12H,9-10H2,1-2H3.
What are the key properties of CID 58399109?
CID 58399109 has a molecular weight of 290.37 g/mol, XLogP of 4.05, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 58399109 is sourced from PubChem (CID 58399109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).