C29H29NO7 — CID 58399539
(3aR,6S,6aS,9aS,9bR)-6a-hydroxy-6,9a-dimethyl-4'-(2-nitrophenyl)-5'-phenylspiro[4,5,6,9b-tetrahydro-3aH-azuleno[8,7-b]furan-3,2'-oxolane]-2,9-dione (PubChem CID 58399539) has the molecular formula C29H29NO7 and a molecular weight of 503.55 g/mol. Its IUPAC name is (3aR,6S,6aS,9aS,9bR)-6a-hydroxy-6,9a-dimethyl-4'-(2-nitrophenyl)-5'-phenylspiro[4,5,6,9b-tetrahydro-3aH-azuleno[8,7-b]furan-3,2'-oxolane]-2,9-dione.
| Compound Name | (3aR,6S,6aS,9aS,9bR)-6a-hydroxy-6,9a-dimethyl-4'-(2-nitrophenyl)-5'-phenylspiro[4,5,6,9b-tetrahydro-3aH-azuleno[8,7-b]furan-3,2'-oxolane]-2,9-dione |
|---|---|
| PubChem CID | 58399539 |
| Molecular Formula | C29H29NO7 |
| Molecular Weight | 503.55 g/mol |
| Exact Mass | 503.19 |
| IUPAC Name | (3aR,6S,6aS,9aS,9bR)-6a-hydroxy-6,9a-dimethyl-4'-(2-nitrophenyl)-5'-phenylspiro[4,5,6,9b-tetrahydro-3aH-azuleno[8,7-b]furan-3,2'-oxolane]-2,9-dione |
| SMILES | C[C@H]1CC[C@@H]2[C@@H](OC(=O)C23CC(c2ccccc2[N+](=O)[O-])C(c2ccccc2)O3)[C@]2(C)C(=O)C=C[C@@]12O |
| InChI | InChI=1S/C29H29NO7/c1-17-12-13-21-25(27(2)23(31)14-15-29(17,27)33)36-26(32)28(21)16-20(19-10-6-7-11-22(19)30(34)35)24(37-28)18-8-4-3-5-9-18/h3-11,14-15,17,20-21,24-25,33H,12-13,16H2,1-2H3/t17-,20?,21+,24?,25+,27-,28?,29+/m0/s1 |
| InChIKey | GSUCFJYCRMNITP-ROHZNASBSA-N |
| XLogP | 4.43 |
| TPSA | 115.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.55 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|