C34H24N8O4P2 — CID 58399840
5-[4-(5-oxo-4,6-diphenyl-[1,3,2]diazaphospholo[4,5-c][1,2,5]oxadiazol-5-yl)phenyl]-4,6-diphenyl-[1,3,2]diazaphospholo[4,5-c][1,2,5]oxadiazole 5-oxide (PubChem CID 58399840) has the molecular formula C34H24N8O4P2 and a molecular weight of 670.57 g/mol. Its IUPAC name is 5-[4-(5-oxo-4,6-diphenyl-[1,3,2]diazaphospholo[4,5-c][1,2,5]oxadiazol-5-yl)phenyl]-4,6-diphenyl-[1,3,2]diazaphospholo[4,5-c][1,2,5]oxadiazole 5-oxide.
| Compound Name | 5-[4-(5-oxo-4,6-diphenyl-[1,3,2]diazaphospholo[4,5-c][1,2,5]oxadiazol-5-yl)phenyl]-4,6-diphenyl-[1,3,2]diazaphospholo[4,5-c][1,2,5]oxadiazole 5-oxide |
|---|---|
| PubChem CID | 58399840 |
| Molecular Formula | C34H24N8O4P2 |
| Molecular Weight | 670.57 g/mol |
| Exact Mass | 670.14 |
| IUPAC Name | 5-[4-(5-oxo-4,6-diphenyl-[1,3,2]diazaphospholo[4,5-c][1,2,5]oxadiazol-5-yl)phenyl]-4,6-diphenyl-[1,3,2]diazaphospholo[4,5-c][1,2,5]oxadiazole 5-oxide |
| SMILES | O=P1(c2ccc(P3(=O)N(c4ccccc4)c4nonc4N3c3ccccc3)cc2)N(c2ccccc2)c2nonc2N1c1ccccc1 |
| InChI | InChI=1S/C34H24N8O4P2/c43-47(39(25-13-5-1-6-14-25)31-32(36-45-35-31)40(47)26-15-7-2-8-16-26)29-21-23-30(24-22-29)48(44)41(27-17-9-3-10-18-27)33-34(38-46-37-33)42(48)28-19-11-4-12-20-28/h1-24H |
| InChIKey | CAABALTUCCKWTB-UHFFFAOYSA-N |
| XLogP | 8.07 |
| TPSA | 124.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.57 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|